A3139012
2,4-Di-tert-butylphenol , 97% , 96-76-4
CAS NO.:96-76-4
Empirical Formula: C14H22O
Molecular Weight: 206.32
MDL number: MFCD00008828
EINECS: 202-532-0
| Pack Size | Price | Stock | Quantity |
| 100G | RMB29.60 | In Stock |
|
| 250G | RMB63.20 | In Stock |
|
| 500G | RMB85.60 | In Stock |
|
| 2.5KG | RMB367.20 | In Stock |
|
| 10kg | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 53-56 °C(lit.) |
| Boiling point: | 265 °C(lit.) |
| Density | 0.887 |
| vapor pressure | 1 mm Hg ( 84.5 °C) |
| refractive index | 1.5080 |
| Flash point: | 239 °F |
| storage temp. | Store below +30°C. |
| solubility | water: soluble0.033g/L at 25°C |
| pka | 11.56±0.18(Predicted) |
| form | Crystalline Solid |
| color | White to yellow |
| PH | 4.5 (H2O, 20℃)(saturated aqueous solution) |
| Water Solubility | practically insoluble |
| BRN | 1910383 |
| Stability: | Stable. Combustible. Incompatible with acid chlorides, oxidizing agents, acid anhydrides, copper, copper alloys, bases, brass. |
| InChI | 1S/C14H22O/c1-13(2,3)10-7-8-12(15)11(9-10)14(4,5)6/h7-9,15H,1-6H3 |
| InChIKey | ICKWICRCANNIBI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(O)c(c1)C(C)(C)C |
| LogP | 4.8 at 23℃ |
| CAS DataBase Reference | 96-76-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 2,4-bis(1,1-dimethylethyl)-(96-76-4) |
| EPA Substance Registry System | 2,4-Di-tert-butylphenol (96-76-4) |
Description and Uses
Phenolic Phosphites, UV Stabilizer Intermediate
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS09 |
| Signal word | Danger |
| Hazard statements | H315-H318-H410 |
| Precautionary statements | P273-P280-P302+P352-P305+P351+P338+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,N,Xn,T,F |
| Risk Statements | 36/37/38-50/53-43-36/38-22-51/53-41-39/23/24/25-23/24/25-11-52/53 |
| Safety Statements | 26-36/37-61-37/39-29-24-45-36/37/39-60 |
| RIDADR | UN 2430 8/PG 3 |
| WGK Germany | 2 |
| RTECS | SK8260000 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29071900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Irrit. 2 |
| Hazardous Substances Data | 96-76-4(Hazardous Substances Data) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






