2′-Deoxycytidine monohydrate , 99% , 951-77-9
CAS NO.:951-77-9
Empirical Formula: C9H13N3O4
Molecular Weight: 227.22
MDL number: MFCD00006547
EINECS: 213-454-1
| Pack Size | Price | Stock | Quantity |
| 500MG | RMB30.40 | In Stock |
|
| 1G | RMB44.00 | In Stock |
|
| 5G | RMB104.80 | In Stock |
|
| 25g | RMB398.40 | In Stock |
|
| 100g | RMB1436.80 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 209-211 °C(lit.) |
| Boiling point: | 368.93°C (rough estimate) |
| Density | 1.3171 (rough estimate) |
| refractive index | 59 ° (C=1, H2O) |
| storage temp. | -20°C |
| solubility | H2O: 50 mg/mL, clear, colorless |
| form | Crystalline Powder |
| pka | 14.03±0.60(Predicted) |
| color | White |
| PH | 4.3 |
| biological source | synthetic (organic) |
| optical activity | Consistent with structure |
| Water Solubility | Soluble in water, DMSO. |
| λmax | 280 (pH 1);271 (pH 7) |
| BRN | 87567 |
| Cosmetics Ingredients Functions | HAIR CONDITIONING |
| InChI | InChI=1S/C9H13N3O4/c10-7-1-2-12(9(15)11-7)8-3-5(14)6(4-13)16-8/h1-2,5-6,8,13-14H,3-4H2,(H2,10,11,15)/t5-,6+,8+/m0/s1 |
| InChIKey | CKTSBUTUHBMZGZ-SHYZEUOFSA-N |
| SMILES | OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O |
| CAS DataBase Reference | 951-77-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Deoxycytidine(951-77-9) |
| EPA Substance Registry System | Cytidine, 2'-deoxy- (951-77-9) |
Description and Uses
2'-Deoxycytidine (2'-dU) is a deoxyribonucleotide that is used in the synthesis of DNA. 2'-Deoxycytidine has been shown to inhibit the kinase activity of IL-2 receptor and Toll-like receptor, which are proteins that regulate the immune response. 2'-Deoxycytidine also inhibits DNA polymerase activity and thermal expansion, which may make it a good candidate as an anticancer drug.
2'-Deoxycytidine (deoxyC) is one of the deoxynucleosides which after phosphorylation to dCTP is used to synthesis DNA via various DNA polymerases or reverse transcriptases. 2'-Deoxycytidine (deoxyC) is the substrate for deoxycytidine deaminase (EC 3.5.4.14) which converts it into 2-deoxyuridine. 2-Deoxycytidine is phosphorylated to the nucleotide dCMP by the enzyme deoxycytidine kinase (DCK).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P304+P340 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | HA3800000 |
| F | 10 |
| TSCA | TSCA listed |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |





