5-Fluoro-2′-deoxyuridine , 99% , 50-91-9
Synonym(s):
floxuridine;FUDR;5-Fluoro-2′-deoxyuridine;FdUrd, FUdR, 5-FdU, Floxuridine;2′-Deoxy-5-fluorouridine
CAS NO.:50-91-9
Empirical Formula: C9H11FN2O5
Molecular Weight: 246.19
MDL number: MFCD00006530
EINECS: 200-072-5
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB25.60 | In Stock |
|
| 250mg | RMB35.20 | In Stock |
|
| 500MG | RMB57.60 | In Stock |
|
| 1G | RMB60.80 | In Stock |
|
| 5G | RMB190.40 | In Stock |
|
| 25G | RMB792.80 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 148 °C(lit.) |
| Boiling point: | 150 °C |
| alpha | 35.9 º (c=1, water) |
| Density | 1.3751 (estimate) |
| storage temp. | room temp |
| solubility | Soluble to 100 mM in water and to 100 mM in DMSO |
| pka | pKa 7.44 (Uncertain) |
| form | Powder |
| color | White to almost white |
| biological source | synthetic (organic) |
| Water Solubility | soluble |
| Merck | 14,4112 |
| BRN | 2645818 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C9H11FN2O5/c10-4-2-12(9(16)11-8(4)15)7-1-5(14)6(3-13)17-7/h2,5-7,13-14H,1,3H2,(H,11,15,16)/t5-,6+,7+/m0/s1 |
| InChIKey | ODKNJVUHOIMIIZ-GFCOJPQKSA-N |
| SMILES | OC[C@H]1O[C@H](C[C@@H]1O)N2C=C(F)C(=O)NC2=O |
| CAS DataBase Reference | 50-91-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Uridine, 2'-deoxy-5-fluoro-(50-91-9) |
| EPA Substance Registry System | Floxuridine (50-91-9) |
Description and Uses
Floxuridine is a nucleoside analog that inhibits the enzyme ribonucleotide reductase, which is involved in the synthesis of DNA. Floxuridine has been shown to inhibit the growth of cancer cells and induce apoptosis in vivo. Floxuridine has also been shown to inhibit tumor growth in animal models by inhibiting the production of reactive oxygen species and upregulating tumor suppressor genes, such as p53. This drug also has inhibitory effects on enzymes that are involved in cell proliferation, such as protein kinase C and tyrosine kinases.
Floxuridine USP is used in Palliative treatment of gastrointestinal adenocarcinoma with liver metastases.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 22-68-36/37/38-40-20/21/22 |
| Safety Statements | 22-36-36/37/39-26 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | YU7525000 |
| F | 10-23 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Hazardous Substances Data | 50-91-9(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 215mg/kg |






