A3152612
Diethyl fumarate , 98% , 623-91-6
CAS NO.:623-91-6
Empirical Formula: C8H12O4
Molecular Weight: 172.18
MDL number: MFCD00064455
EINECS: 210-819-7
| Pack Size | Price | Stock | Quantity |
| 25G | RMB33.60 | In Stock |
|
| 100G | RMB90.40 | In Stock |
|
| 500G | RMB324.00 | In Stock |
|
| 2.5kg | RMB1480.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 1-2 °C (lit.) |
| Boiling point: | 218-219 °C (lit.) |
| Density | 1.052 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 197 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 3.1g/l |
| form | Liquid |
| color | Clear colorless to slightly yellow |
| Water Solubility | immiscible |
| BRN | 775347 |
| Dielectric constant | 6.5(23℃) |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, acids, bases, reducing agents. |
| InChI | 1S/C8H12O4/c1-3-11-7(9)5-6-8(10)12-4-2/h5-6H,3-4H2,1-2H3/b6-5+ |
| InChIKey | IEPRKVQEAMIZSS-AATRIKPKSA-N |
| SMILES | [H]\C(=C(\[H])C(=O)OCC)C(=O)OCC |
| LogP | 2.200 (est) |
| Surface tension | 31.4 mN/m at 22° |
| CAS DataBase Reference | 623-91-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Butenedioic acid (E)-, diethyl ester(623-91-6) |
| EPA Substance Registry System | Diethyl fumarate (623-91-6) |
Description and Uses
It is used as a pesticide or comonomer for the production of polystyrene.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H302 |
| Precautionary statements | P210e-P264-P280a-P301+P312a-P403+P235-P501a |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 23-24/25 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| RTECS | EM5950000 |
| TSCA | TSCA listed |
| HS Code | 29171990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 623-91-6(Hazardous Substances Data) |






