A3156012
N.N'-Disuccinimidyl Carbonate , 98% , 74124-79-1
Synonym(s):
N-Succinimidyl carbonate;Di(N-succinimidyl) carbonate;Di-(N,N′-succinimidyl) carbonate;DSC;N,N′-Disuccinimidyl carbonate, Di-(N-Succinimidyl)carbonate
CAS NO.:74124-79-1
Empirical Formula: C9H8N2O7
Molecular Weight: 256.17
MDL number: MFCD00009767
EINECS: 277-730-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB44.80 | In Stock |
|
| 100G | RMB159.20 | In Stock |
|
| 500g | RMB655.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190 °C (dec.)(lit.) |
| Boiling point: | 399.41°C (rough estimate) |
| Density | 1.5670 (rough estimate) |
| refractive index | 1.5600 (estimate) |
| storage temp. | -20°C |
| solubility | Dichloromethane (Slightly, Heated), DMSO |
| form | Crystalline Powder |
| color | White to slightly yellow |
| Water Solubility | Soluble in dimethyl sulfoxide, hot pyridine, acetonitrile and most organic solvents. Insoluble in water. |
| BRN | 1499137 |
| Stability: | Moisture Sensitive |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C9H8N2O7/c12-5-1-2-6(13)10(5)17-9(16)18-11-7(14)3-4-8(11)15/h1-4H2 |
| InChIKey | PFYXSUNOLOJMDX-UHFFFAOYSA-N |
| SMILES | C(ON1C(=O)CCC1=O)(=O)ON1C(=O)CCC1=O |
| CAS DataBase Reference | 74124-79-1(CAS DataBase Reference) |
Description and Uses
N,N'-Disuccinimidyl carbonate is a convenient reagent for the synthesis of N-succinimidyl esters of N-protected amino acids.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H319-H373 |
| Precautionary statements | P260-P264-P270-P301+P312-P305+P351+P338-P314 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | No |
| HS Code | 29299000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 STOT RE 2 Oral |
| REACH Registrations | Active |








