A3156012
                    N.N'-Disuccinimidyl Carbonate , 98% , 74124-79-1
                            Synonym(s):
N-Succinimidyl carbonate;Di(N-succinimidyl) carbonate;Di-(N,N′-succinimidyl) carbonate;DSC;N,N′-Disuccinimidyl carbonate, Di-(N-Succinimidyl)carbonate
                            
                        
                CAS NO.:74124-79-1
Empirical Formula: C9H8N2O7
Molecular Weight: 256.17
MDL number: MFCD00009767
EINECS: 277-730-3
| Pack Size | Price | Stock | Quantity | 
| 5G | RMB24.00 | In Stock | 
                                                 | 
                                        
| 25G | RMB44.80 | In Stock | 
                                                 | 
                                        
| 100G | RMB159.20 | In Stock | 
                                                 | 
                                        
| 500g | RMB655.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 190 °C (dec.)(lit.) | 
                                    
| Boiling point: | 399.41°C (rough estimate) | 
                                    
| Density | 1.5670 (rough estimate) | 
                                    
| refractive index | 1.5600 (estimate) | 
                                    
| storage temp. | -20°C | 
                                    
| solubility | Dichloromethane (Slightly, Heated), DMSO | 
                                    
| form | Crystalline Powder | 
                                    
| color | White to slightly yellow | 
                                    
| Water Solubility | Soluble in dimethyl sulfoxide, hot pyridine, acetonitrile and most organic solvents. Insoluble in water. | 
                                    
| BRN | 1499137 | 
                                    
| Stability: | Moisture Sensitive | 
                                    
| InChI | InChI=1S/C9H8N2O7/c12-5-1-2-6(13)10(5)17-9(16)18-11-7(14)3-4-8(11)15/h1-4H2 | 
                                    
| InChIKey | PFYXSUNOLOJMDX-UHFFFAOYSA-N | 
                                    
| SMILES | C(ON1C(=O)CCC1=O)(=O)ON1C(=O)CCC1=O | 
                                    
| CAS DataBase Reference | 74124-79-1(CAS DataBase Reference) | 
                                    
Description and Uses
N,N'-Disuccinimidyl carbonate is a convenient reagent for the synthesis of N-succinimidyl esters of N-protected amino acids.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302-H319-H373 | 
| Precautionary statements | P260-P264-P270-P301+P312-P305+P351+P338-P314 | 
| Hazard Codes | Xn,Xi | 
| Risk Statements | 22-36/37/38 | 
| Safety Statements | 26-37/39-36 | 
| WGK Germany | 3 | 
| F | 10-21 | 
| TSCA | No | 
| HS Code | 29299000 | 








