A7762212
N,N,N',N'-Tetramethylchloroformamidinium hexafluorophosphate , 98% , 94790-35-9
CAS NO.:94790-35-9
Empirical Formula: C5H12ClF6N2P
Molecular Weight: 280.58
MDL number: MFCD01862891
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB55.20 | In Stock |
|
| 100G | RMB159.20 | In Stock |
|
| 500g | RMB639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 99-104 °C |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Soluble in water or 1% acetic acid |
| form | powder to crystal |
| color | White to Almost white |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C5H12ClN2.F6P/c1-7(2)5(6)8(3)4;1-7(2,3,4,5)6/h1-4H3;/q+1;-1 |
| InChIKey | CUKNPSDEURGZCO-UHFFFAOYSA-N |
| SMILES | [P+5]([F-])([F-])([F-])([F-])([F-])[F-].C(/Cl)(=[N+](\C)/C)\N(C)C |
| CAS DataBase Reference | 94790-35-9(CAS DataBase Reference) |
Description and Uses
Coupling reagent for peptide synthesis and starting material for preparing other coupling reagents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-40 |
| Safety Statements | 26-36-22 |
| WGK Germany | 3 |
| F | 3-10-21 |
| HS Code | 2931599090 |
| Storage Class | 11 - Combustible Solids |






