A3158912
Di-tert-butyl azodicarboxylate , 98% , 870-50-8
Synonym(s):
Bis(1,1-dimethylethyl)azodicarboxylate;DBAD;Di-tert-butyl azodiformate;NSC 109889
CAS NO.:870-50-8
Empirical Formula: C10H18N2O4
Molecular Weight: 230.26
MDL number: MFCD00015001
EINECS: 212-796-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB68.00 | In Stock |
|
| 100g | RMB247.20 | In Stock |
|
| 500g | RMB1157.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 89-92 °C(lit.) |
| Boiling point: | 287.1±9.0 °C(Predicted) |
| Density | 1.06±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Crystals or Crystalline Powder |
| color | Yellow |
| Water Solubility | Insoluble |
| Sensitive | Light Sensitive |
| BRN | 1911434 |
| InChI | InChI=1S/C10H18N2O4/c1-9(2,3)15-7(13)11-12-8(14)16-10(4,5)6/h1-6H3 |
| InChIKey | QKSQWQOAUQFORH-VAWYXSNFSA-N |
| SMILES | N(C(OC(C)(C)C)=O)=NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 870-50-8(CAS DataBase Reference) |
Description and Uses
Utilized in the asymmetric Friedel-Crafts amination via a chiral organocatalyst.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H304-H315-H320-H332-H335-H336-H360-H370-H372-H401-H319 |
| Precautionary statements | P201-P202-P210-P233-P240-P241+P242+P243-P260-P264-P270-P271-P273-P280-P301+P310+P331-P302+P352+P332+P313+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P307+P311-P403+P233-P405-P261-P280a-P304+P340-P305+P351+P338-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,F |
| Risk Statements | 36/37/38-11 |
| Safety Statements | 26-36-37/39-16 |
| RIDADR | 1325 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29270000 |
| Storage Class | 11 - Combustible Solids |








