A3168712
meso-2,3-Dibromosuccinic acid , 98% , 608-36-6
Synonym(s):
meso -Dibromosuccinic acid
CAS NO.:608-36-6
Empirical Formula: C4H4Br2O4
Molecular Weight: 275.88
MDL number: MFCD00066439
EINECS: 208-396-9
| Pack Size | Price | Stock | Quantity |
| 25g | RMB45.60 | In Stock |
|
| 100G | RMB48.80 | In Stock |
|
| 500G | RMB162.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 288-290 °C(lit.) |
| Boiling point: | 262.4±40.0 °C(Predicted) |
| Density | 2.486±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 20 g/L (17°C) |
| form | Powder |
| pka | pK1:1.51;pK2:2.71 (20°C) |
| color | White to pale yellow to beige |
| Water Solubility | 20 g/L (17 ºC) |
| Merck | 14,3029 |
| BRN | 1725173 |
| InChI | 1S/C4H4Br2O4/c5-1(3(7)8)2(6)4(9)10/h1-2H,(H,7,8)(H,9,10)/t1-,2+ |
| InChIKey | FJWGRXKOBIVTFA-XIXRPRMCSA-N |
| SMILES | OC(=O)[C@@H](Br)[C@@H](Br)C(O)=O |
| CAS DataBase Reference | 608-36-6(CAS DataBase Reference) |
Description and Uses
meso-2,3-dibromosuccinic acid is used in organic synthesis & pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,Xi |
| Risk Statements | 34-36/37/38 |
| Safety Statements | 26-36/37/39-45-24/25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29171900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







