A3169212
(Diacetoxyiodo)benzene , 98% , 3240-34-4
Synonym(s):
Iodobenzene diacetate;Iodosobenzene diacetate;Iodobenzene I,I-diacetate;Iodosobenzene I,I-diacetate;Phenyl-iodanediyl diacetate
CAS NO.:3240-34-4
Empirical Formula: C10H11IO4
Molecular Weight: 322.1
MDL number: MFCD00008692
EINECS: 221-808-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB49.60 | In Stock |
|
| 100G | RMB144.00 | In Stock |
|
| 500G | RMB1820.80 | In Stock |
|
| 2.5kg | RMB5599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 161-163 °C (lit.) |
| Density | 1.6865 (estimate) |
| refractive index | n/D 1.444 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | INSOLUBLE |
| form | Solution |
| color | Clear to cloudy colorless to yellow |
| biological source | mouse |
| Water Solubility | INSOLUBLE |
| Sensitive | Light Sensitive |
| BRN | 1879369 |
| Stability: | Light and Moisture sensitive |
| InChI | 1S/C10H11IO4/c1-8(12)14-11(15-9(2)13)10-6-4-3-5-7-10/h3-7H,1-2H3 |
| InChIKey | ZBIKORITPGTTGI-UHFFFAOYSA-N |
| SMILES | CC(OI(OC(C)=O)C1=CC=CC=C1)=O |
| CAS DataBase Reference | 3240-34-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Iodobenzene diacetate(3240-34-4) |
| EPA Substance Registry System | Iodine, bis(acetato-.kappa.O)phenyl- (3240-34-4) |
Description and Uses
(Diacetoxyiodo)benzene is a hypervalent iodine reagent that is used in conjunction with catalytic amount of sodium azide in acetonitrile, which enables oxidative decarboxylation of 2-aryl carboxylic acid into the corresponding aldehydes, ketones and nitriles.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26-36/37/39-27 |
| RIDADR | 1479 |
| WGK Germany | 3 |
| RTECS | DA3525000 |
| F | 4.10-8 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29310095 |
| Storage Class | 11 - Combustible Solids |





