A3173112
Diisopropyl malonate , 99% , 13195-64-7
CAS NO.：13195-64-7
Empirical Formula: C9H16O4
Molecular Weight: 188.22
MDL number: MFCD00059359
EINECS: 236-156-3
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB23.20 | In Stock |
|
| 100ML | RMB51.20 | In Stock |
|
| 500ML | RMB174.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -51°C(lit.) |
| Boiling point: | 93-95 °C/12 mmHg (lit.) |
| Density | 0.991 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 192 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| pka | 13.79±0.46(Predicted) |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C9H16O4/c1-6(2)12-8(10)5-9(11)13-7(3)4/h6-7H,5H2,1-4H3 |
| InChIKey | QRVSDVDFJFKYKA-UHFFFAOYSA-N |
| SMILES | C(OC(C)C)(=O)CC(OC(C)C)=O |
| CAS DataBase Reference | 13195-64-7(CAS DataBase Reference) |
Description and Uses
Diisopropyl malonates may be used in the synthesis of :
- 3-substituted coumarins
- 2-carboisopropoxy-3-hydroxyquinoxaline-di-N-oxide
- 2-carboisopropoxy-3-hydroxy-6-methoxylquinoxaline-di-N-oxide
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29171900 |
