A3176112
Diacetone-D-galactose , 95% , 4064-06-6
Synonym(s):
1,2:3,4-Di-O-isopropylidene-D -galactopyranose
CAS NO.:4064-06-6
Empirical Formula: C12H20O6
Molecular Weight: 260.28
MDL number: MFCD00063225
EINECS: 223-771-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB67.20 | In Stock |
|
| 5G | RMB235.20 | In Stock |
|
| 25G | RMB879.20 | In Stock |
|
| 100g | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120-122 °C |
| Boiling point: | 117 °C/0.015 mmHg (lit.) |
| alpha | -57.5 º (c=3, CHCl3) |
| Density | 1.143 g/mL at 25 °C (lit.) |
| refractive index | n |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in Acetone, Chloroform and Methanol. |
| pka | 14.00±0.10(Predicted) |
| form | Viscous Paste |
| color | Clear pale yellow to yellow |
| optical activity | [α]25/D 59°, c = 3 in chloroform |
| BRN | 1345410 |
| InChI | InChI=1/C12H20O6/c1-11(2)15-7-6(5-13)14-10-9(8(7)16-11)17-12(3,4)18-10/h6-10,13H,5H2,1-4H3/t6-,7+,8+,9-,10-/s3 |
| InChIKey | POORJMIIHXHXAV-DPMQDVBJNA-N |
| SMILES | [C@H]12OC(C)(C)O[C@H]1[C@H](O[C@@H]1OC(C)(C)O[C@H]21)CO |&1:0,6,7,9,15,r| |
| CAS DataBase Reference | 4064-06-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Galactopyranose, 1,2:3,4-di-o-isopropylidene-, d-(4064-06-6) |
Description and Uses
Diacetone-D-galactose is used to produce diacetone-d-galacturonic acid and oxalic acid. It is mainly used in biochemical reaction and used as medicine intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36/37-26 |
| WGK Germany | 3 |
| F | 3-9-21 |
| HS Code | 29400090 |
| Storage Class | 10 - Combustible liquids |





