PRODUCT Properties
| Melting point: | 98-100 °C(lit.) |
| Boiling point: | 275-280°C (1 mmHg) |
| Density | 1.28 g/mL at 25 °C |
| vapor density | <1 (vs air) |
| vapor pressure | <0.1 mm Hg ( 25 °C) |
| refractive index | n |
| Flash point: | 275-280°C/1mm |
| storage temp. | 2-8°C |
| solubility | H2O: 1 M at 20 °C, clear, colorless |
| pka | pKa 13.57(H2O
t = 18
t = 0)(Approximate);14.14(H2O
t = 18
t = 0)(Approximate) |
| form | liquid |
| color | White to Off-white |
| PH | 6.0-6.5 (50g/l, H2O, 20℃) |
| Odor | Odorless. |
| Water Solubility | SOLUBLE IN HOT WATER |
| Sensitive | Hygroscopic |
| Merck | 14,4332 |
| BRN | 1721903 |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5+,6- |
| InChIKey | FBPFZTCFMRRESA-GUCUJZIJSA-N |
| SMILES | OC[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)CO |
| LogP | -3.100 |
| CAS DataBase Reference | 608-66-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Galactitol(608-66-2) |
| EPA Substance Registry System | Galactitol (608-66-2) |
Description and Uses
Dulcitol is the reduction product of Galactose. An increase in the level of Dulcitol is often a result of metabolism defect caused by a defect in galactose-1-phosphate uridylyltransferase (an autosomal recessive disorder). Dulcitol buildup can also lead t
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 8-24/25-36/37-26 |
| WGK Germany | 2 |
| RTECS | LZ4290000 |
| F | 3 |
| TSCA | TSCA listed |
| HS Code | 29054990 |
| Storage Class | 11 - Combustible Solids |



![2-[2-(2-Azidoethoxy)ethoxy]ethyl 2,3,4,6-Tetra-<i>O</i>-acetyl-<small>D</small>-galactopyranoside](https://img.chemicalbook.com/CAS/GIF/381716-33-2.gif)
