A3177112
Dimethyl N-Cyanodithiocarbonimidate , 90% , 10191-60-3
CAS NO.:10191-60-3
Empirical Formula: C4H6N2S2
Molecular Weight: 146.23
MDL number: MFCD00009825
EINECS: 233-467-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB56.00 | In Stock |
|
| 100G | RMB145.60 | In Stock |
|
| 250g | RMB271.20 | In Stock |
|
| 500G | RMB483.20 | In Stock |
|
| 2.5kg | RMB2159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45-50 °C (lit.) |
| Boiling point: | 229.6±23.0 °C(Predicted) |
| Density | 1.298 (estimate) |
| refractive index | 1.5000 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Slightly soluble in methanol. |
| pka | -5.10±0.50(Predicted) |
| form | solid |
| Appearance | White to off-white Solid |
| BRN | 635998 |
| InChI | InChI=1S/C4H6N2S2/c1-7-4(8-2)6-3-5/h1-2H3 |
| InChIKey | IULFXBLVJIPESI-UHFFFAOYSA-N |
| SMILES | C(=N/C#N)(/SC)\SC |
| CAS DataBase Reference | 10191-60-3(CAS DataBase Reference) |
| NIST Chemistry Reference | N-Cyano-s,s'-dimethyldithioimido carbonate(10191-60-3) |
| EPA Substance Registry System | Carbonimidodithioic acid, cyano-, dimethyl ester (10191-60-3) |
Description and Uses
Dimethyl cyanodithioiminocarbonate has been used in the synthesis of 4-methylthiopyrazolo[1,5-a]-1,3,5-triazines, methylsulfanylpyrimidines, cyanoguanidines and N-aryl-6-methylsulfanyl-4-oxopyrimidine-5-carbonitriles. It has been also used in the synthesis of methylsulfanyl derivatives of azoloazines and azoloazoles.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P260-P270-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,T |
| Risk Statements | 22-34-23/24/25-36/37 |
| Safety Statements | 26-36/37/39-45-38-28A-7/9 |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| F | 13-19 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29309090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








