A3491012
Diphenyl <i>N</i>-Cyanocarbonimidate , >97.0%(HPLC) , 79463-77-7
CAS NO.:79463-77-7
Empirical Formula: C14H10N2O2
Molecular Weight: 238.24
MDL number: MFCD00010380
EINECS: 427-300-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB39.20 | In Stock |
|
| 5G | RMB151.20 | In Stock |
|
| 25g | RMB639.20 | In Stock |
|
| 100g | RMB1719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155-158 °C (lit.) |
| Boiling point: | 380.84°C (rough estimate) |
| Density | 1.1907 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | sol THF, propan-2-ol. |
| form | Fluffy Powder |
| pka | -6.70±0.50(Predicted) |
| color | White |
| Water Solubility | Insoluble in water. |
| Sensitive | Moisture Sensitive |
| BRN | 4254248 |
| InChI | InChI=1S/C14H10N2O2/c15-11-16-14(17-12-7-3-1-4-8-12)18-13-9-5-2-6-10-13/h1-10H |
| InChIKey | SLIKWVTWIGHFJE-UHFFFAOYSA-N |
| SMILES | C(=N/C#N)(/OC1=CC=CC=C1)\OC1=CC=CC=C1 |
| CAS DataBase Reference | 79463-77-7(CAS DataBase Reference) |
Description and Uses
Diphenyl Cyanocarbonimidate (DPCC) is used for preparation of heterocycles, 1,2,4-triazoles, 4-oxa-1,3-diazoles, benzimidazoles, hexahydropyrimidines, and hydroquinazolines; synthesis of O-phenylisoureas, N-cyanoguanidines, and guanidines; modification of peptides; reverse electron demand Diels-Alder heterodieneophile.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H318-H412 |
| Precautionary statements | P273-P280-P305+P351+P338-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 3 Eye Dam. 1 |






