A3178112
N,N-Dibenzylhydroxylamine , 98% , 621-07-8
CAS NO.：621-07-8
Empirical Formula: C14H15NO
Molecular Weight: 213.27
MDL number: MFCD00004772
EINECS: 210-667-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB31.20 | In Stock |
|
| 25G | RMB41.60 | In Stock |
|
| 100G | RMB99.20 | In Stock |
|
| 500G | RMB388.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125-128 °C (lit.) |
| Boiling point: | 353.27°C (rough estimate) |
| Density | 1.0439 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| pka | 13.19±0.69(Predicted) |
| color | White to Almost white |
| BRN | 978234 |
| InChI | InChI=1S/C14H15NO/c16-15(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10,16H,11-12H2 |
| InChIKey | GXELTROTKVKZBQ-UHFFFAOYSA-N |
| SMILES | C1(CN(O)CC2=CC=CC=C2)=CC=CC=C1 |
| CAS DataBase Reference | 621-07-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Hydroxylamine, n,n-dibenzyl-,(621-07-8) |
| EPA Substance Registry System | Benzenemethanamine, N-hydroxy-N-(phenylmethyl)- (621-07-8) |
Description and Uses
N,N-Dibenzylhydroxylamine, upon oxidation, yields N-benzyl-α-phenylnitrone, which can undergo cycloaddition reaction with suitable dipolarophiles. It can be used to synthesize N,N,O-trisubstituted hydroxylamines and arylamines.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 2928.00.2500 |
