A8455032
1,5-Diphenyl-1,4-Pentadien-3-One , 98% , 538-58-9
Synonym(s):
trans,trans-1,5-Diphenyl-1,4-pentadien-3-one;1,5-Diphenyl-1,4-pentadien-3-one
CAS NO.:538-58-9
Empirical Formula: C17H14O
Molecular Weight: 234.29
MDL number: MFCD00004790
EINECS: 208-697-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB60.00 | In Stock |
|
| 100G | RMB167.20 | In Stock |
|
| 500g | RMB716.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 107-113 °C |
| Boiling point: | 336.62°C (rough estimate) |
| Density | 1.0477 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| color | yellow |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
| InChI | InChI=1S/C17H14O/c18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16/h1-14H |
| InChIKey | WMKGGPCROCCUDY-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1)=CC(=O)C=CC1=CC=CC=C1 |
| CAS DataBase Reference | 538-58-9(CAS DataBase Reference) |
| EPA Substance Registry System | 1,4-Pentadien-3-one, 1,5-diphenyl- (538-58-9) |
Description and Uses
Dibenzylideneacetone is used as a ligand to prepare palladium catalysts, which are widely used in catalytic hydrogenation, coupling, carbonylation, alkyne ring trimerization, etc.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335-H413 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2914790090 |






