A3179112
Dicyclopropyl Ketone , 95% , 1121-37-5
Synonym(s):
Dicyclopropylketone
CAS NO.:1121-37-5
Empirical Formula: C7H10O
Molecular Weight: 110.15
MDL number: MFCD00001276
EINECS: 214-331-5
| Pack Size | Price | Stock | Quantity |
| 5ml | RMB39.20 | In Stock |
|
| 25ML | RMB145.60 | In Stock |
|
| 100ML | RMB484.00 | In Stock |
|
| 500ml | RMB1967.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 44.0-44.5 °C |
| Boiling point: | 160-162 °C(lit.) |
| Density | 0.977 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 103 °F |
| storage temp. | Store below +30°C. |
| form | liquid |
| Specific Gravity | 0.957 |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | Soluble in water. |
| BRN | 774172 |
| InChI | InChI=1S/C7H10O/c8-7(5-1-2-5)6-3-4-6/h5-6H,1-4H2 |
| InChIKey | BIPUHAHGLJKIPK-UHFFFAOYSA-N |
| SMILES | C(C1CC1)(C1CC1)=O |
| CAS DataBase Reference | 1121-37-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Methanone, dicyclopropyl-(1121-37-5) |
Description and Uses
Dicyclopropyl Ketone is used as a reagent in the synthesis of a new class of potent and selective agonists of dimeric carbamoylguanidine-type histamine H2 receptor ligands. Also used in the preparation of chemical space analogs of PNU-282,987 and SSR180711, which have nicotinic receptor activity.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210-P233-P240-P241-P242-P243 |
| Hazard Codes | F,Xn |
| Risk Statements | 10-36/37/38-20/21/22-5 |
| Safety Statements | 16-36-26-3 |
| RIDADR | UN 1224 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29142900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





![9-BENZYL-1,6-DIPHENYL-9-AZADISPIRO[2.1.2.3]DECAN-4-ONE](https://img.chemicalbook.com/StructureFile/ChemBookStructure5/GIF/CB4376154.gif)
