A3187812
1,3-Diaminoguanidine monohydrochloride , 97% , 36062-19-8
CAS NO.：36062-19-8
Empirical Formula: CH8ClN5
Molecular Weight: 125.56
MDL number: MFCD00012948
EINECS: 252-854-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.80 | In Stock |
|
| 10g | RMB36.00 | In Stock |
|
| 25G | RMB49.60 | In Stock |
|
| 100G | RMB153.60 | In Stock |
|
| 500g | RMB759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180-182 °C (dec.)(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | water: soluble50mg/mL, clear to very slightly hazy, colorless to faintly yellow |
| form | Granular Powder |
| color | White to light beige |
| Water Solubility | very faint turbidity |
| Sensitive | Hygroscopic |
| BRN | 3556702 |
| InChI | InChI=1S/CH7N5.ClH/c2-1(5-3)6-4;/h3-4H2,(H3,2,5,6);1H |
| InChIKey | HAZRIBSLCUYMQP-UHFFFAOYSA-N |
| SMILES | C(=N)(NN)NN.Cl |
| CAS DataBase Reference | 36062-19-8(CAS DataBase Reference) |
Description and Uses
N,N''-Diaminoguanidine Monohydrochloride is an analyte for HPLC. It also functions as an intermediate for the synthesis of energetic salts or materials based on dinitroguanidine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29212900 |
