A3189612
4,5-Dicyanoimidazole , 98% , 1122-28-7
Synonym(s):
4,5-Imidazoledicarbonitrile
CAS NO.:1122-28-7
Empirical Formula: C5H2N4
Molecular Weight: 118.1
MDL number: MFCD00005194
EINECS: 214-344-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB106.40 | In Stock |
|
| 100G | RMB392.80 | In Stock |
|
| 500g | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168-175 °C(lit.) |
| Boiling point: | 569.3±35.0 °C(Predicted) |
| Density | 0.791 g/mL at 25 °C |
| Flash point: | 50 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in Acetonitrile: 1.8g/10ml, DMSO, Methanol. |
| pka | 5.01±0.10(Predicted) |
| form | Crystalline Powder |
| color | solid white |
| BRN | 118208 |
| InChI | InChI=1S/C5H2N4/c6-1-4-5(2-7)9-3-8-4/h3H,(H,8,9) |
| InChIKey | XGDRLCRGKUCBQL-UHFFFAOYSA-N |
| SMILES | C1NC(C#N)=C(C#N)N=1 |
| CAS DataBase Reference | 1122-28-7(CAS DataBase Reference) |
Description and Uses
4,5-Dicyanoimidazole is used in activation of nucleoside phosphoramidites during solid-phase oligonucleotide synthesis, and synthesis of nucleoside phosphoramidites, synthesis of novel nucleosides. It is often used as an alternative to tetrazole.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn,F |
| Risk Statements | 37/38-41-36/37/38-20/22-36-20/21/22-11 |
| Safety Statements | 26-39-36/37/39-36/37-16 |
| RIDADR | UN 1648 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






