A3191112
4,4′-Dipyridyl disulfide , 98% , 2645-22-9
Synonym(s):
4,4′-Dipyridyl disulfide;4,4′-Dithiodipyridine
CAS NO.：2645-22-9
Empirical Formula: C10H8N2S2
Molecular Weight: 220.31
MDL number: MFCD00006423
EINECS: 220-158-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB127.20 | In Stock |
|
| 5G | RMB413.60 | In Stock |
|
| 25G | RMB1724.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76-78 °C(lit.) |
| Boiling point: | 356.1±17.0 °C(Predicted) |
| Density | 1.3078 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | 2-8°C |
| solubility | 95% ethanol: soluble5%, clear, colorless to light yellow |
| form | Crystalline Powder |
| pka | 3.60±0.26(Predicted) |
| color | White to orange |
| BRN | 154742 |
| InChI | InChI=1S/C10H8N2S2/c1-5-11-6-2-9(1)13-14-10-3-7-12-8-4-10/h1-8H |
| InChIKey | UHBAPGWWRFVTFS-UHFFFAOYSA-N |
| SMILES | S(C1C=CN=CC=1)SC1C=CN=CC=1 |
| CAS DataBase Reference | 2645-22-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyridine, 4,4'-dithiobis-(2645-22-9) |
Description and Uses
- Aldrithiol?-4 was used as cosubstrate in a study to develop highly specific inhibitors against mannose-binding lectin-associated serine proteases by in vitro evolution technology:phage display.
- It was used to study the O2 equilibria of recombinant human neuroglobin and cytoglobin measured under close to physiological conditions.
- It was used to modify gold surfaces for protein studies.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29333990 |
