Dimethomorph , Analysis of standard products, Mixtureofe+Zisomers: 98% , 110488-70-5
CAS NO.：110488-70-5
Empirical Formula: C21H22ClNO4
Molecular Weight: 387.86
MDL number: MFCD01632781
EINECS: 404-200-2
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB286.40 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 125-149°C |
| Boiling point: | 584.9±50.0 °C(Predicted) |
| Density | 1.231±0.06 g/cm3(Predicted) |
| vapor pressure | 1 x 10-6 Pa (25 °C) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform: Soluble,Methanol: Soluble |
| pka | -1.19±0.20(Predicted) |
| Water Solubility | 50 mg l-1 (20-23 °C) |
| form | Solid |
| color | White to off-white |
| Merck | 13,3248 |
| BRN | 8794474 |
| Major Application | agriculture environmental |
| InChI | 1S/C21H22ClNO4/c1-25-19-8-5-16(13-20(19)26-2)18(15-3-6-17(22)7-4-15)14-21(24)23-9-11-27-12-10-23/h3-8,13-14H,9-12H2,1-2H3/b18-14+ |
| InChIKey | QNBTYORWCCMPQP-NBVRZTHBSA-N |
| SMILES | COc1ccc(cc1OC)\C(=C\C(=O)N2CCOCC2)c3ccc(Cl)cc3 |
| LogP | 2.680 |
| EPA Substance Registry System | Dimethomorph (110488-70-5) |
Description and Uses
Dimethomorph is a morpholine fungicide that inhibits fungal cell wall formation. It inhibits mycelial growth of the oomycete fungi P. citrophthora, P. parasitica, P. capsici, and P. infestans (EC50s = 0.14, 0.38, <0.1, and 0.16-0.3 μg/ml, respectively) but is less active against the green algae species C. vulgaris or S. obliquus in vitro (EC50s = 47.46 and 44.87 μg/ml, respectively). It inhibits androgen receptor (AR) activity in a reporter assay in MDA-kb2 human breast cancer cells but not in a yeast antiandrogen screen (IC20s = 0.263 and 38.5 μM, respectively). It is not toxic to rats (LD50 = 3,900 mg/kg) or goldfish (C. auratus; LC50 = >32 μg/ml).
Agricultural fungicide.
Safety
| Symbol(GHS) |   GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H360F-H411 |
| Precautionary statements | P202-P273-P280-P308+P313-P391-P405 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 51/53 |
| Safety Statements | 61 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | QE0478300 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 2 Repr. 1B |
| Hazardous Substances Data | 110488-70-5(Hazardous Substances Data) |
| Toxicity | LD50 in rats (mg/kg): 321 i.p.; 3900 orally; >5000 dermally; LC50 (4-hr inhalation): >4.2 mg/ml (Veenstra, Owen) |
