A3197112
cis-2,6-Dimethylpiperazine , 98% , 21655-48-1
CAS NO.：21655-48-1
Empirical Formula: C6H14N2
Molecular Weight: 114.19
MDL number: MFCD07772435
EINECS: 606-812-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB27.20 | In Stock |
|
| 25G | RMB97.60 | In Stock |
|
| 100G | RMB356.00 | In Stock |
|
| 500G | RMB1572.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 108-111 °C(lit.) |
| Boiling point: | 162 °C(lit.) |
| Density | 0.9140 (estimate) |
| refractive index | 1.4628 (estimate) |
| Flash point: | 113 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| Water Solubility | Completely soluble in water |
| form | powder to crystal |
| pka | 9.38±0.60(Predicted) |
| color | White to Orange to Green |
| Sensitive | Light Sensitive & Hygroscopic |
| InChI | InChI=1/C6H14N2/c1-5-3-7-4-6(2)8-5/h5-8H,3-4H2,1-2H3/t5-,6+ |
| InChIKey | IFNWESYYDINUHV-OLQVQODUNA-N |
| SMILES | C[C@@H]1CNC[C@@H](N1)C |&1:1,5,r| |
| CAS DataBase Reference | 21655-48-1(CAS DataBase Reference) |
Description and Uses
cis-2,6-Dimethylpiperazine is a very versatile reagent used in the preparation of biologically active compounds such as antibacterial agents.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H228-H315-H319-H335 |
| Precautionary statements | P210-P240-P241-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338-P405-P501a |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 26-36-24/25 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| F | 3-8-10-34 |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29335990 |
