A3198012
4,4′-Dihydroxybenzophenone , 98% , 611-99-4
CAS NO.:611-99-4
Empirical Formula: C13H10O3
Molecular Weight: 214.22
MDL number: MFCD00002358
EINECS: 210-288-1
| Pack Size | Price | Stock | Quantity |
| 25G | RMB39.20 | In Stock |
|
| 100G | RMB138.40 | In Stock |
|
| 500G | RMB479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 213-215 °C(lit.) |
| Boiling point: | 314.35°C (rough estimate) |
| Density | 1.1330 |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.5090 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 7.67±0.15(Predicted) |
| form | Fine Crystalline Powder |
| color | Off-white to beige |
| Water Solubility | insoluble |
| BRN | 1874572 |
| InChI | 1S/C13H10O3/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8,14-15H |
| InChIKey | RXNYJUSEXLAVNQ-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1)C(=O)c2ccc(O)cc2 |
| LogP | 2.5 |
| CAS DataBase Reference | 611-99-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Bis(4-hydroxyphenyl)methanone(611-99-4) |
Description and Uses
4,4'-Dihydroxybenzophenone is as a UV light stabilizer. It and its derivatives are found in cosmetics, plastics, films, adhesives and coatings, optical fiber, and printed circuit boards. It is the precursor to certain polycarbonate polymers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 26-36/37-37/39-36 |
| WGK Germany | 3 |
| RTECS | DJ0880000 |
| TSCA | TSCA listed |
| HS Code | 29145000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |



