A3198712
Diphenylphosphinic acid , 99% , 1707-03-5
CAS NO.:1707-03-5
Empirical Formula: C12H11O2P
Molecular Weight: 218.19
MDL number: MFCD00002132
EINECS: 216-948-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB69.60 | In Stock |
|
| 100G | RMB204.00 | In Stock |
|
| 500G | RMB836.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193-195 °C(lit.) |
| Boiling point: | 194 °C |
| Density | 1.25±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 0.1 M NaOH: soluble0.5g/10 mL, clear, colorless |
| pka | 2.30±0.10(Predicted) |
| form | Fine Crystalline Solid |
| color | White |
| Water Solubility | Soluble in water. |
| BRN | 2804567 |
| InChI | InChI=1S/C12H11O2P/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H,13,14) |
| InChIKey | BEQVQKJCLJBTKZ-UHFFFAOYSA-N |
| SMILES | P(C1=CC=CC=C1)(C1=CC=CC=C1)(O)=O |
| CAS DataBase Reference | 1707-03-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Diphenyl phosphinic acid(1707-03-5) |
Description and Uses
Diphenylphosphinic acid is used as a reagent employed in the synthesis of bidentate ligands and peptide coupling agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | SZ5315000 |
| HS Code | 29310095 |
| Storage Class | 11 - Combustible Solids |







