A3105012
Diphenyl-2-pyridylphosphine , 97% , 37943-90-1
Synonym(s):
2-(Diphenylphosphino)pyridine;2-Pyridyldiphenylphosphine;Diphenyl(2-pyridinyl)phosphine
CAS NO.:37943-90-1
Empirical Formula: C17H14NP
Molecular Weight: 263.27
MDL number: MFCD00192108
EINECS: 629-049-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB20.00 | In Stock |
|
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB95.20 | In Stock |
|
| 100g | RMB375.20 | In Stock |
|
| 500g | RMB1580.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82-84 °C (dec.) (lit.) |
| Boiling point: | 163 °C(Press: 0.05 Torr) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in toluene. (almost transparency) |
| form | Crystalline Powder |
| pka | 2.37±0.12(Predicted) |
| color | White to yellow to tan |
| InChI | InChI=1S/C17H14NP/c1-3-9-15(10-4-1)19(16-11-5-2-6-12-16)17-13-7-8-14-18-17/h1-14H |
| InChIKey | SVABQOITNJTVNJ-UHFFFAOYSA-N |
| SMILES | C1(P(C2=CC=CC=C2)C2=CC=CC=C2)=NC=CC=C1 |
| CAS DataBase Reference | 37943-90-1(CAS DataBase Reference) |
Description and Uses
Ligand for metal-catalyzed carbonylations, hydration, dehydrogenative coupling, carbostannylation, distannylation, and silylation; reagent for Mitsunobu reaction.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H413 |
| Precautionary statements | P273-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29333990 |







