A3204312
4,4'-Dimethylbenzophenone , 99% , 611-97-2
CAS NO.:611-97-2
Empirical Formula: C15H14O
Molecular Weight: 210.27
MDL number: MFCD00017214
EINECS: 210-287-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB43.20 | In Stock |
|
| 100G | RMB134.40 | In Stock |
|
| 500g | RMB599.20 | In Stock |
|
| 2.5kg | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-93 °C(lit.) |
| Boiling point: | 200 °C17 mm Hg(lit.) |
| Density | 1.0232 (rough estimate) |
| refractive index | 1.5361 (estimate) |
| Flash point: | 200°C/17mm |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| color | Pale brown |
| Water Solubility | Insoluble in water. |
| BRN | 1240527 |
| InChI | InChI=1S/C15H14O/c1-11-3-7-13(8-4-11)15(16)14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChIKey | ZWPWLKXZYNXATK-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(C)C=C1)(C1=CC=C(C)C=C1)=O |
| CAS DataBase Reference | 611-97-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 4,4'-Dimethyl benzophenone(611-97-2) |
| EPA Substance Registry System | Methanone, bis(4-methylphenyl)- (611-97-2) |
Description and Uses
4,4'-Dimethylbenzophenone is used as catalytic agent and petrochemical additive. It is also used as pharmaceutical intermediates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29143990 |
| Storage Class | 11 - Combustible Solids |



