A3204812
4,5-Diphenylimidazole , 98% , 668-94-0
CAS NO.:668-94-0
Empirical Formula: C15H12N2
Molecular Weight: 220.27
MDL number: MFCD00005198
EINECS: 211-573-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB159.20 | In Stock |
|
| 25G | RMB423.20 | In Stock |
|
| 100g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 228-230 °C(lit.) |
| Boiling point: | 351.21°C (rough estimate) |
| Density | 1.149 |
| refractive index | 1.5000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in methanol. |
| pka | 12.99±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 157587 |
| InChI | 1S/C15H12N2/c1-3-7-12(8-4-1)14-15(17-11-16-14)13-9-5-2-6-10-13/h1-11H,(H,16,17) |
| InChIKey | CPHGOBGXZQKCKI-UHFFFAOYSA-N |
| SMILES | c1ccc(cc1)-c2nc[nH]c2-c3ccccc3 |
| CAS DataBase Reference | 668-94-0(CAS DataBase Reference) |
Description and Uses
4,5-Diphenylimidazole is used as a precursor for azo dyes such as 2-(quinolylazo)-4,5-diphenylimidazole . It is also used to determine metal ions by spectrophotometrically. It acts as a chromogenic reagent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29332990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






