PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| Boiling point: | 407.5±55.0 °C(Predicted) |
| Density | 1.1917 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| pka | 10.17±0.70(Predicted) |
| form | solid |
| BRN | 187613 |
| InChI | 1S/C15H12N2S/c18-15-16-13(11-7-3-1-4-8-11)14(17-15)12-9-5-2-6-10-12/h1-10H,(H2,16,17,18) |
| InChIKey | GMTAWLUJHGIUPU-UHFFFAOYSA-N |
| SMILES | Sc1nc(-c2ccccc2)c([nH]1)-c3ccccc3 |
| CAS DataBase Reference | 2349-58-8(CAS DataBase Reference) |
Description and Uses
4,5-Diphenyl-2-imidazolethiol may be used in chemical synthesis studies.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H227-H302-H311+H331-H315-H319-H335 |
| Precautionary statements | P261-P280-P305+P351+P338-P311 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29332990 |
| Storage Class | 11 - Combustible Solids |





