A3213412
Dimethyl yellow , Indicator , 60-11-7
Synonym(s):
N,N-Dimethyl-4-(phenylazo)aniline;4-(Dimethylamino)azobenzene;Butter yellow;Dimethyl yellow;Methyl yellow
CAS NO.:60-11-7
Empirical Formula: C14H15N3
Molecular Weight: 225.29
MDL number: MFCD00008308
EINECS: 200-455-7
| Pack Size | Price | Stock | Quantity |
| 25G | RMB25.60 | In Stock |
|
| 100G | RMB66.40 | In Stock |
|
| 500G | RMB277.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 111 °C (dec.)(lit.) |
| Boiling point: | 356.8°C (rough estimate) |
| Density | 1.1303 (rough estimate) |
| vapor pressure | 3 x 10-7 mmHg (estimated, NIOSH, 1997) |
| refractive index | 1.5770 (estimate) |
| storage temp. | Store at RT. |
| solubility | Insoluble in water; soluble in ethanol, benzene, ether, chloroform,petroleum ether, mineralacids, oils |
| Colour Index | 11020 |
| form | Powder |
| pka | 3.226(at 25℃) |
| color | Yellow |
| PH | 2.9-4.0 |
| PH Range | 2.9(red)-4(yellow/orange) |
| Water Solubility | 13.6 mg/L |
| λmax | 408nm, 256nm, 508nm |
| Merck | 14,3229 |
| BRN | 746016 |
| Stability: | Stable, but heat and light sensitive. Incompatible with strong oxidizing agents, strong acids. |
| Major Application | Electrochromic materials, sol-gel coatings, display device, inks, gasdetection apparatus, status assessment indetection apparatus, nematocides, hair dyes, diapers, food storage, status assessment inbreast cancer, detecting carbohydrates, bacteria, diagnosing cervical disease, wound dressing materials |
| InChI | 1S/C14H15N3/c1-17(2)14-10-8-13(9-11-14)16-15-12-6-4-3-5-7-12/h3-11H,1-2H3 |
| InChIKey | JCYPECIVGRXBMO-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(cc1)N=Nc2ccccc2 |
| CAS DataBase Reference | 60-11-7(CAS DataBase Reference) |
| IARC | 2B (Vol. 8, Sup 7) 1987 |
| NIST Chemistry Reference | Benzenamine, N,N-dimethyl-4-(phenylazo)-(60-11-7) |
| EPA Substance Registry System | 4-Dimethylaminoazobenzene (60-11-7) |
Description and Uses
4-N,N-Dimethylaminobenzene diazonium chloride is a diazo compound found in diazo copy paper. It is allergenic only when unexposed.
Butter yellow was largely used as a food coloring agent. It was also used for the determination of free hydrochloric acid in gastric juice, for the spot test identification of peroxidized fats, as a pH indicator, and as a laboratory reagent.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H351 |
| Precautionary statements | P201-P301+P310+P330 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 25-40-68-45-23/24/25 |
| Safety Statements | 36/37-45-53-22 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | BX7350000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29270000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Carc. 2 |
| Hazardous Substances Data | 60-11-7(Hazardous Substances Data) |
| Toxicity | Acute oral LD50 for mice 300 mg/kg, rats 200 mg/kg (quoted, RTECS, 1985). |








