PRODUCT Properties
| Density | 1.445[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| Water Solubility | 170.1mg/L at 20℃ |
| Cosmetics Ingredients Functions | COLORANT |
| InChI | InChI=1S/2C17H13N4O3.Cr/c2*1-11-15(16(22)21(20-11)12-7-3-2-4-8-12)19-18-14-10-6-5-9-13(14)17(23)24;/h2*2-10H,1H3,(H,23,24);/q2*-1;+3/p-1/b2*19-18+; |
| InChIKey | IHWYTZCAOLKLQM-VFUQPONKSA-M |
| SMILES | O=C1C2C=CC=CC=2N2=N[C-]3C(C)=NN(C4C=CC=CC=4)C3=O[Cr+3]342([O-]C(=O)C2C=CC=CC=2N3=N[C-]2C(C)=NN(C3C=CC=CC=3)C2=O4)[O-]1.[H+] |
| LogP | 1.098 at 20℃ |
| EPA Substance Registry System | Chromate(1-), bis[2-[[4,5-dihydro-3-methyl-5-(oxo-.kappa.O)-1-phenyl-1H-pyrazol-4-yl]azo-.kappa.N1]benzoato(2-)-.kappa.O]-, hydrogen (5601-29-6) |
Description and Uses
CI 18690 is classed chemically as a monoazo colour. It is a chromium complex of the color
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H412-H319-H317 |
| Precautionary statements | P273-P501-P264-P280-P305+P351+P338-P337+P313P-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501 |
