A3214412
Diethyl dithio carbamic acid silver salt , 98% , 1470-61-7
Synonym(s):
DETC;Diethyldithiocarbamic acid silver salt;Silver diethyldithiocarbamate
CAS NO.：1470-61-7
Empirical Formula: C5H10AgNS2
Molecular Weight: 256.14
MDL number: MFCD00004929
EINECS: 216-003-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB75.20 | In Stock |
|
| 25G | RMB278.40 | In Stock |
|
| 50G | RMB507.20 | In Stock |
|
| 100g | RMB935.20 | In Stock |
|
| 250g | RMB2275.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 172-175 °C (lit.) |
| bulk density | 340kg/m3 |
| storage temp. | 2-8°C |
| solubility | soluble in pyridine |
| form | Powder/Solid |
| color | White |
| PH | 5.0-6.5 (H2O)suspension |
| Water Solubility | It is soluble in water and pyridine. |
| Sensitive | Light Sensitive |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 3718150 |
| InChI | InChI=1S/C5H11NS2.Ag/c1-3-6(4-2)5(7)8;/h3-4H2,1-2H3,(H,7,8);/q;+1/p-1 |
| InChIKey | NSVHDIYWJVLAGH-UHFFFAOYSA-M |
| SMILES | N(CC)(CC)C(=S)S[Ag] |
| CAS DataBase Reference | 1470-61-7(CAS DataBase Reference) |
| EPA Substance Registry System | Silver diethyldithiocarbamate (1470-61-7) |
Description and Uses
Silver Diethyldithiocarbamate is useful in the colorimetric determination of arsenic and the introduction of the diethyldithiocarbamato ligand. Silver diethyldithiocarbamate is also useful as a copper chelator. Dyes and metabolites.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8 |
| TSCA | Yes |
| HS Code | 2843 29 00 |
