A3215812
3,4-Dimethoxybenzenesulfonyl chloride , 98% , 23095-31-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.80 | In Stock |
|
| 5G | RMB141.60 | In Stock |
|
| 25G | RMB558.40 | In Stock |
|
| 100G | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-70 °C (lit.) |
| Boiling point: | 346.2±27.0 °C(Predicted) |
| Density | 1.359±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Chloroform, Ethyl Acetate |
| form | Crystalline Powder |
| color | Off-white to beige |
| Sensitive | Moisture Sensitive |
| BRN | 2840170 |
| InChI | 1S/C8H9ClO4S/c1-12-7-4-3-6(14(9,10)11)5-8(7)13-2/h3-5H,1-2H3 |
| InChIKey | RSJSYCZYQNJQPY-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1OC)S(Cl)(=O)=O |
| CAS DataBase Reference | 23095-31-0(CAS DataBase Reference) |
Description and Uses
3,4-Dimethoxybenzenesulfonyl Chloride is used in the synthesis of aryl sulfonamides as selective carbonic anhydrase IX and XII inhibitors.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P405-P501a-P280-P305+P351+P338-P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





![7-Chloro-2,3-dihydrobenzo[b][1,4]dioxine-6-sulfonylchloride](https://img.chemicalbook.com/CAS/GIF/889939-46-2.gif)
![2,3-Dihydrobenzo[b][1,4]dioxine-6-sulfonylchloride](https://img.chemicalbook.com/CAS/GIF/63758-12-3.gif)