A3217312
2′-Deoxyadenosine 5′-monophosphate , 98% , 653-63-4
Synonym(s):
2′-Deoxyadenylic acid;dAMP
CAS NO.:653-63-4
Empirical Formula: C10H14N5O6P
Molecular Weight: 331.22
MDL number: MFCD00005753
EINECS: 211-503-1
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB119.20 | In Stock |
|
| 500MG | RMB399.20 | In Stock |
|
| 1G | RMB639.20 | In Stock |
|
| 5g | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148 °C |
| Boiling point: | 753.5±70.0 °C(Predicted) |
| Density | 2.17 |
| storage temp. | -20°C |
| solubility | DMSO (Slightly) |
| pka | 1.86±0.10(Predicted) |
| form | Crystalline Powder |
| color | White |
| biological source | synthetic (organic) |
| Water Solubility | Soluble in 1N ammonium hhydroxide (50 mg/ml) and water. |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C10H14N5O6P/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(21-7)2-20-22(17,18)19/h3-7,16H,1-2H2,(H2,11,12,13)(H2,17,18,19)/t5-,6+,7+/m0/s1 |
| InChIKey | KHWCHTKSEGGWEX-RRKCRQDMSA-N |
| SMILES | P(OC[C@H]1O[C@@H](N2C3C(=C(N=CN=3)N)N=C2)C[C@@H]1O)(O)(O)=O |
| CAS DataBase Reference | 653-63-4(CAS DataBase Reference) |
Description and Uses
2’-
2’-Deoxyadenosine 5’Monophosphate is the first nucleotide of the phi 29 DNA.
Safety
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-37/39-24/25 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |






