A3218312
Dihydrouracil , 97% , 504-07-4
Synonym(s):
5,6-Dihydro-2,4-dihydroxypyrimidine
CAS NO.:504-07-4
Empirical Formula: C4H6N2O2
Molecular Weight: 114.1
MDL number: MFCD00006029
EINECS: 207-982-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB95.20 | In Stock |
|
| 1G | RMB217.60 | In Stock |
|
| 5G | RMB689.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 279-281 °C (lit.) |
| Boiling point: | 213.59°C (rough estimate) |
| Density | 1.3565 (rough estimate) |
| refractive index | 1.4487 (estimate) |
| storage temp. | 2-8°C |
| solubility | Soluble in Sodium Hydroxide. |
| form | Solid |
| pka | 12.10±0.20(Predicted) |
| color | White to Light Beige |
| BRN | 112496 |
| InChI | InChI=1S/C4H6N2O2/c7-3-1-2-5-4(8)6-3/h1-2H2,(H2,5,6,7,8) |
| InChIKey | OIVLITBTBDPEFK-UHFFFAOYSA-N |
| SMILES | C1(=O)NCCC(=O)N1 |
| CAS DataBase Reference | 504-07-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2,4(1H,3H)-Pyrimidinedione, dihydro- (504-07-4) |
Description and Uses
Dihydrouracil has been used as a standard for ureido group in the colorimentric assay of transfer ribonucleic acid (tRNA).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H227 |
| Precautionary statements | P501-P210-P264-P280-P302+P352-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313-P403+P235 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |







