A3681612
5,5-<WBR>Dibromobarbituric acid , 97% , 511-67-1
CAS NO.:511-67-1
Empirical Formula: C4H2Br2N2O3
Molecular Weight: 285.88
MDL number: MFCD00010595
EINECS: 208-131-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB48.80 | In Stock |
|
| 25g | RMB126.40 | In Stock |
|
| 100g | RMB368.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 240-242 °C(lit.) |
| Density | 2.5685 (rough estimate) |
| refractive index | 1.6220 (estimate) |
| storage temp. | Storage temp. 2-8°C |
| solubility | DMSO (Sparingly) |
| pka | pKa 5.68±0.02(H2O t=25.0±0.02 I=0.00)(Approximate) |
| form | Solid |
| color | Pale Beige to Light Orange |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C4H2Br2N2O3/c5-4(6)1(9)7-3(11)8-2(4)10/h(H2,7,8,9,10,11) |
| InChIKey | AMATXUCYHHHHHB-UHFFFAOYSA-N |
| SMILES | C1(=O)NC(=O)C(Br)(Br)C(=O)N1 |
Description and Uses
5,5-Dibromobarbituric acid was used in the synthesis of condensed pteridine system by undergoing condensation with 4,5-diamino-pyrimidines in the presence of pyridine.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2933599590 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |





