A3219112
2,2'-Biquinoline-4,4'-dicarboxylic acid , 90% , 1245-13-2
Synonym(s):
2,2′-Bicinchoninic acid
CAS NO.:1245-13-2
Empirical Formula: C20H12N2O4
Molecular Weight: 344.32
MDL number: MFCD00068342
EINECS: 214-990-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.80 | In Stock |
|
| 5G | RMB159.20 | In Stock |
|
| 25G | RMB637.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 365°C(lit.) |
| Boiling point: | 626.2±55.0 °C(Predicted) |
| Density | 1.468±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 1.77±0.10(Predicted) |
| color | Light yellow to Yellow to Orange |
| BRN | 321561 |
| InChI | InChI=1S/C20H12N2O4/c23-19(24)13-9-17(21-15-7-3-1-5-11(13)15)18-10-14(20(25)26)12-6-2-4-8-16(12)22-18/h1-10H,(H,23,24)(H,25,26) |
| InChIKey | AFYNADDZULBEJA-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C(C(O)=O)=CC=1C1C=C(C(O)=O)C2C(N=1)=CC=CC=2 |
| CAS DataBase Reference | 1245-13-2(CAS DataBase Reference) |
| EPA Substance Registry System | [2,2'-Biquinoline]-4,4'-dicarboxylic acid (1245-13-2) |
Description and Uses
2,2′-Biquinoline-4,4′-dicarboxylic acid has been used in a study that synthesized and structurally characterized six metal-organic coordination polymers.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Danger |
| Hazard statements | H225 |
| Precautionary statements | P210-P403+P235 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| F | 8-10 |
| TSCA | TSCA listed |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |






