A3219412
1,3-Dichloro-1,1,3,3-tetramethyldisiloxane , 95% , 2401-73-2
CAS NO.:2401-73-2
Empirical Formula: C4H12Cl2OSi2
Molecular Weight: 203.21
MDL number: MFCD00018088
EINECS: 219-278-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB151.20 | In Stock |
|
| 25G | RMB594.40 | In Stock |
|
| 100g | RMB2055.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -37 °C |
| Boiling point: | 138 °C (lit.) |
| Density | 1.039 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 15 °C |
| storage temp. | Flammables area |
| form | liquid |
| Specific Gravity | 1.038 |
| color | Colorless to Almost colorless |
| Water Solubility | Reacts with water. |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | Moisture Sensitive |
| BRN | 1741218 |
| InChI | 1S/C4H12Cl2OSi2/c1-8(2,5)7-9(3,4)6/h1-4H3 |
| InChIKey | DMEXFOUCEOWRGD-UHFFFAOYSA-N |
| SMILES | C[Si](C)(Cl)O[Si](C)(C)Cl |
| CAS DataBase Reference | 2401-73-2(CAS DataBase Reference) |
| EPA Substance Registry System | Disiloxane, 1,3-dichloro-1,1,3,3-tetramethyl- (2401-73-2) |
Description and Uses
1,3-Dichlorotetramethyldisiloxane is used to produce 1,1,3,3-tetramethyl-disiloxane-1,3-diol. It is also used as Chemical Additives. Pharmaceutical intermediates.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H225-H314 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,C |
| Risk Statements | 11-34 |
| Safety Statements | 16-26-27-36/37/39-45 |
| RIDADR | UN 2985 3/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 Skin Corr. 1B |
| Excepted Quantities | Not Permitted as Excepted Quantity |








