PRODUCT Properties
| Melting point: | 46-49 °C |
| Boiling point: | 215 °C |
| Density | 1.076 |
| refractive index | 1.598 |
| Flash point: | 193°C |
| form | solid |
| Specific Gravity | 1.076 |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | InChI=1S/C26H26OSi2/c1-28(23-15-7-3-8-16-23,24-17-9-4-10-18-24)27-29(2,25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22H,1-2H3 |
| InChIKey | RFGGTTPASBFBTB-UHFFFAOYSA-N |
| SMILES | [Si](C)(C1=CC=CC=C1)(C1=CC=CC=C1)O[Si](C)(C1=CC=CC=C1)C1=CC=CC=C1 |
| EPA Substance Registry System | Disiloxane, 1,3-dimethyl-1,1,3,3-tetraphenyl- (807-28-3) |
Description and Uses
Tetraphenyl Dimethyl Disiloxane is the siloxane
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | Yes |
