A3226112
Diclobutrazol , Analysis of standard products, three -dimensional heterogeneous mixture , 75736-33-3
CAS NO.:75736-33-3
Empirical Formula: C15H19Cl2N3O
Molecular Weight: 328.24
MDL number: MFCD00144110
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB546.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147-149° |
| Boiling point: | 484.3±55.0 °C(Predicted) |
| Density | 1.28±0.1 g/cm3(Predicted) |
| Flash point: | >100 °C |
| storage temp. | 0-6°C |
| pka | 13.86±0.20(Predicted) |
| form | Solid |
| color | White to off-white |
| Merck | 13,3107 |
| Major Application | agriculture environmental |
| InChI | 1S/C15H19Cl2N3O/c1-15(2,3)14(21)13(20-9-18-8-19-20)6-10-4-5-11(16)7-12(10)17/h4-5,7-9,13-14,21H,6H2,1-3H3 |
| InChIKey | URDNHJIVMYZFRT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(O)C(Cc1ccc(Cl)cc1Cl)n2cncn2 |
| NIST Chemistry Reference | 1H-1,2,4-triazole-1-ethanol, «beta»-((2,4-dichlorophenyl)methyl)-«alpha»-(1,1-dimethylethyl)-,(r*,r*)-(.+/-.)-(75736-33-3) |
| EPA Substance Registry System | 1H-1,2,4-Triazole-1-ethanol, .beta.-[(2,4-dichlorophenyl)methyl]-.alpha.-(1,1-dimethylethyl)-, (.alpha.R,.beta.R)-rel- (75736-33-3) |
Description and Uses
Diclobutrazol, a systemic fungicide, is highly active against rusts, powdery mildews, and other fungal phytopathogens. Diclobutrazol can be used as a pesticide to control of various crop diseases, such as powdery mildew, smut of wheat, sheath blight of rice, etc.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H319-H411 |
| Precautionary statements | P264-P273-P280-P305+P351+P338-P337+P313-P391 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi;N,N,Xi |
| Risk Statements | 36-51/53 |
| Safety Statements | 26-61 |
| RIDADR | UN 3077 |
| WGK Germany | 2 |
| RTECS | XZ4804000 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 |
| Toxicity | LD50 in rats (mg/kg): ~4000 orally; >1000 dermally; in mallard ducks: >9000 orally (Bent, Skidmore) |






