PRODUCT Properties
| Melting point: | 184-187 °C (lit.) |
| Boiling point: | 273.68°C (rough estimate) |
| Density | 1.4410 (rough estimate) |
| refractive index | 1.4590 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.46±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | 147.1mg/L(temperature not stated) |
| BRN | 2044776 |
| InChI | InChI=1S/C7H4Cl2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H,10,11) |
| InChIKey | CXKCZFDUOYMOOP-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Cl)=CC(Cl)=C1 |
| CAS DataBase Reference | 51-36-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Dichlorobenzoic acid(51-36-5) |
| EPA Substance Registry System | 3,5-Dichlorobenzoic acid (51-36-5) |
Description and Uses
3,5-Dichlorobenzoic acid is used in organic synthesis and pesticide and pharmaceutical intermediates. It can be used to synthesize 3,5-Dichloro-N-(4-hydroxyphenethyl)benzamide and (3,5-Dichlorophenyl)-(4-fluorophenyl)methanone.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | DG7350000 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Toxicity | mouse,LD50,intraperitoneal,237mg/kg (237mg/kg),BEHAVIORAL: REGIDITYBEHAVIORAL: MUSCLE CONTRACTION OR SPASTICITY),Journal of Medicinal Chemistry. Vol. 11, Pg. 1020, 1968. |
