PRODUCT Properties
| Melting point: | 264-266 °C (lit.) |
| Boiling point: | 297.29°C (rough estimate) |
| Density | 1.5281 (rough estimate) |
| refractive index | 1.4845 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.83±0.10(Predicted) |
| color | White to Off-White |
| BRN | 2616297 |
| InChI | InChI=1S/C7H4Cl2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12) |
| InChIKey | AULKDLUOQCUNOK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Cl)=C(O)C(Cl)=C1 |
| CAS DataBase Reference | 3336-41-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Dichloro-4-hydroxybenzoic acid(3336-41-2) |
Description and Uses
3,5-Dichloro-4-hydroxybenzoic Acid can be used as cyclin dependent kinase inhibitors to treat cell proliferative disorders, such as, cancer.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | DG7502000 |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




