PRODUCT Properties
| Melting point: | 225° |
| Boiling point: | 402.1±45.0 °C(Predicted) |
| Density | d18 1.55 |
| refractive index | 1.6360 (estimate) |
| storage temp. | 0-6°C |
| Water Solubility | 0.5mg/L(temperature not stated) |
| Merck | 13,3404 |
| BRN | 1325563 |
| Major Application | agriculture environmental |
| InChI | 1S/C14H4N2O2S2/c15-5-9-10(6-16)20-14-12(18)8-4-2-1-3-7(8)11(17)13(14)19-9/h1-4H |
| InChIKey | PYZSVQVRHDXQSL-UHFFFAOYSA-N |
| SMILES | O=C1C2=C(SC(C#N)=C(S2)C#N)C(=O)c3ccccc13 |
| LogP | 2.840 |
| CAS DataBase Reference | 3347-22-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Dithianone(3347-22-6) |
| EPA Substance Registry System | Dithianon (3347-22-6) |
Description and Uses
Dithianone is an anthraquinone derivative, used as a fungicide. With cymoxanil, it is contained in Aktuan. Cases have been sparsely reported for agricultural workers.
Fungicide.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H317-H318-H330-H410 |
| Precautionary statements | P273-P280-P301+P312+P330-P302+P352-P304+P340+P310-P305+P351+P338+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn;N,N,Xn |
| Risk Statements | 22-50/53 |
| Safety Statements | 24-60-61 |
| RIDADR | UN 3077 |
| WGK Germany | 3 |
| RTECS | QL0700000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 3347-22-6(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats, guinea pigs: 638, 110 mg/kg (Amadori, Heupt) |







