A3227612
Dichloran , Analysis standard , 99-30-9
Synonym(s):
2,6-Dichloro-4-nitroaniline;Dichloran
CAS NO.:99-30-9
Empirical Formula: C6H4Cl2N2O2
Molecular Weight: 207.01
MDL number: MFCD00007677
EINECS: 202-746-4
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB415.20 | In Stock |
|
| 25G | RMB20730.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190-192 °C (lit.) |
| Boiling point: | 130°C 2mm |
| Density | 1.6257 (rough estimate) |
| vapor pressure | 1.6 x 10-4 Pa (20 °C) |
| refractive index | 1.6560 (estimate) |
| Flash point: | 130°C/2mm |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | 0.006g/l (HSDB) |
| pka | pK1:-3.31(+1) (25°C) |
| form | powder |
| color | Light Yellow to Yellow |
| Water Solubility | 1 g/L (60 ºC) |
| BRN | 1459581 |
| InChI | 1S/C6H4Cl2N2O2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H,9H2 |
| InChIKey | BIXZHMJUSMUDOQ-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)cc(cc1Cl)[N+]([O-])=O |
| LogP | 2.800 |
| CAS DataBase Reference | 99-30-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,6-Dichloro-4-nitroaniline(99-30-9) |
| EPA Substance Registry System | Dichloran (99-30-9) |
Description and Uses
Dichloran is a component for pesticide formulations.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H373-H410 |
| Precautionary statements | P262-P273-P280-P302+P352+P310-P304+P340+P310-P314 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn,N,T+ |
| Risk Statements | 33-36/37/38-20/21/22-51/53-26/27/28 |
| Safety Statements | 22-26-36-37/39-61-45-36/37-28 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | BX2975000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29214210 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Chronic 1 STOT RE 2 |
| Hazardous Substances Data | 99-30-9(Hazardous Substances Data) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







