A3228912
[3-(3,5-Dichlorophenyl)-2,5-dioxoimidazolidinyl]-N-(methylethyl)carboxamide standard solution , analyticalstandard,10ug/mlinbenzen , 36734-19-7
Synonym(s):
[3-(3,5-Dichlorophenyl)-2,4-dioxoimidazolidinyl]-N-(methylethyl)carboxamide;Iprodione
CAS NO.:36734-19-7
Empirical Formula: C13H13Cl2N3O3
Molecular Weight: 330.17
MDL number: MFCD00055353
EINECS: 253-178-9
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB127.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130-134 °C(lit.) |
| Density | 1.6223 (rough estimate) |
| vapor pressure | 5 x 10-7 Pa (25 °C) |
| refractive index | 1.6140 (estimate) |
| Flash point: | 2 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO: 100 mg/mL (302.87 mM) |
| pka | 9.19±0.20(Predicted) |
| form | Solid |
| color | White to off-white |
| Water Solubility | 0.0013 g/100 mL |
| Merck | 13,5096 |
| BRN | 895003 |
| Major Application | agriculture cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C13H13Cl2N3O3/c1-7(2)16-12(20)17-6-11(19)18(13(17)21)10-4-8(14)3-9(15)5-10/h3-5,7H,6H2,1-2H3,(H,16,20) |
| InChIKey | ONUFESLQCSAYKA-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)N1CC(=O)N(C1=O)c2cc(Cl)cc(Cl)c2 |
| LogP | 3.000 |
| CAS DataBase Reference | 36734-19-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Iprodione(36734-19-7) |
| EPA Substance Registry System | Iprodione (36734-19-7) |
Description and Uses
Fungicide.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H351-H410 |
| Precautionary statements | P202-P273-P280-P308+P313-P391-P405 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N,F |
| Risk Statements | 40-50/53-36-20/21/22-11 |
| Safety Statements | 36/37-60-61-36-26-16 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | NI8870000 |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 |
| Hazardous Substances Data | 36734-19-7(Hazardous Substances Data) |
| Toxicity | LD50 in mice, rats (g/kg): 4, 3.5 orally (Lacroix, 1980) |

![[3-(3,5-Dichlorophenyl)-2,5-dioxoimidazolidinyl]-N-(methylethyl)carboxamide standard solution](https://img.chemicalbook.com/CAS/GIF/36734-19-7.gif)


