A3229612
1,2-Dichloroethane-d4 , D,99% , 17060-07-0
Synonym(s):
Ethylene-d4 dichloride
| Pack Size | Price | Stock | Quantity |
| 1G | RMB719.20 | In Stock |
|
| 5G | RMB2637.60 | In Stock |
|
| 5×1g | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −35 °C(lit.) |
| Boiling point: | 83 °C(lit.) |
| Density | 1.307 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 60 °F |
| storage temp. | room temp |
| solubility | Acetone (Slightly), DMSO (Sparingly), Methanol (Slightly) |
| form | Liquid |
| Water Solubility | Partially miscible with water. |
| Stability: | Volatile |
| InChI | InChI=1S/C2H4Cl2/c3-1-2-4/h1-2H2 |
| InChIKey | WSLDOOZREJYCGB-UHFFFAOYSA-N |
| SMILES | C([H])([H])(Cl)C([H])([H])Cl |
| CAS DataBase Reference | 17060-07-0(CAS DataBase Reference) |
| EPA Substance Registry System | 1,2-Dichloroethane-d4 (17060-07-0) |
| CAS Number Unlabeled | 107-06-2 |
Description and Uses
1,2-Dichloroethane-d4 is widely used as a solvent for NMR analysis, and in the synthesis of poly(ethylene-d4 oxide) as a chain termination reagent.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H302-H304-H315-H319-H331-H335-H350 |
| Precautionary statements | P210-P301+P310-P303+P361+P353-P304+P340+P311-P305+P351+P338-P331 |
| Hazard Codes | F,T |
| Risk Statements | 45-11-22-36/37/38-39/23/24/25-23/24/25 |
| Safety Statements | 53-45-36/37-16 |
| RIDADR | UN 1184 3/PG 2 |
| WGK Germany | 3 |
| HazardClass | 3 |
| PackingGroup | II |








