A3230012
2,4-Dichloro-5-fluoro-3-nitrobenzoic acid , 97% , 106809-14-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB63.20 | In Stock |
|
| 10g | RMB111.20 | In Stock |
|
| 25G | RMB223.20 | In Stock |
|
| 100G | RMB719.20 | In Stock |
|
| 500g | RMB3039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193-197 °C (lit.) |
| Boiling point: | 390.4±42.0 °C(Predicted) |
| Density | 1.7139 (estimate) |
| storage temp. | 2-8°C |
| form | solid |
| pka | 1.51±0.24(Predicted) |
| color | White to off-white |
| InChI | 1S/C7H2Cl2FNO4/c8-4-2(7(12)13)1-3(10)5(9)6(4)11(14)15/h1H,(H,12,13) |
| InChIKey | PCSAPCNEJUEIGU-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(F)c(Cl)c(c1Cl)[N+]([O-])=O |
| CAS DataBase Reference | 106809-14-7(CAS DataBase Reference) |
Description and Uses
2,4-Dichloro-5-fluoro-3-nitrobenzoic acid may be used to synthesize:
- ethyl 3-(N,N-dimethylamino)-2-(2,4-dichloro-5-fluoro-3-nitrobenzoyl)acrylate
- 7-chloro-1-cyclopropyl-6-fluoro-8-nitro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid
- ethyl-3-(N,N-dimethylamino)-2-(2,4-dichloro-5-fluoro-3-nitrobenzoyl) acrylate
- substituted 4(1H)-oxoquinoline-3-carboxylic acid
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |




