PRODUCT Properties
| Melting point: | 124-127 °C |
| Boiling point: | 232.96°C (rough estimate) |
| Density | 1.581 |
| refractive index | 22 ° (C=1, H2O) |
| storage temp. | Room Temperature |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| pka | 12.45±0.20(Predicted) |
| form | Solid |
| color | White |
| optical activity | [α]20/D +21±1°, 3 hr, c = 1% in H2O |
| BRN | 1724617 |
| InChI | 1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3+,4+,5+,6?/m1/s1 |
| InChIKey | WQZGKKKJIJFFOK-WHZQZERISA-N |
| SMILES | OC[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@H]1O |
| LogP | -3.170 (est) |
| CAS DataBase Reference | 2595-98-4(CAS DataBase Reference) |
Description and Uses
D-Talose is a monosaccharide sugar that can convert between aldose and ketose forms in pyridine in the presence of aluminum oxide.
Safety
| Precautionary statements | P261-P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 2940000080 |
| Storage Class | 11 - Combustible Solids |
