A3232812
Di(1-adamantyl)-n-butylphosphine , 97% , 321921-71-5
Synonym(s):
Di(1-adamantyl)-n-butylphosphine
CAS NO.:321921-71-5
Empirical Formula: C24H39P
Molecular Weight: 358.54
MDL number: MFCD05861606
EINECS: 691-708-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB279.20 | In Stock |
|
| 25G | RMB1119.20 | In Stock |
|
| 100g | RMB3599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 100°C |
| Boiling point: | 449.6±12.0 °C(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Powder |
| color | white to yellow |
| Sensitive | air sensitive |
| BRN | 8726448 |
| InChI | InChI=1S/C24H39P/c1-2-3-4-25(23-11-17-5-18(12-23)7-19(6-17)13-23)24-14-20-8-21(15-24)10-22(9-20)16-24/h17-22H,2-16H2,1H3 |
| InChIKey | HTJWUNNIRKDDIV-UHFFFAOYSA-N |
| SMILES | P(CCCC)(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
| CAS DataBase Reference | 321921-71-5 |
Description and Uses
CataCXium A is a catalyst. CataCXium A is an electron-rich phosphine ligand used for palladium catalyzed cross-coupling reactions like Heck and Suzuki coupling reactions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29310095 |
| Storage Class | 11 - Combustible Solids |





