A3233912
Fmoc-Dap-OH , 97% , 181954-34-7
Synonym(s):
Nα-Fmoc-L -2,3-diaminopropionic acid
CAS NO.:181954-34-7
Empirical Formula: C18H18N2O4
Molecular Weight: 326.35
MDL number: MFCD01076134
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB252.00 | In Stock |
|
| 5G | RMB596.80 | In Stock |
|
| 25G | RMB3183.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 579.5±50.0 °C(Predicted) |
| Density | 1.324±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 2.77±0.16(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | Consistent with structure |
| BRN | 7658592 |
| Major Application | peptide synthesis |
| InChI | 1S/C18H18N2O4/c19-9-16(17(21)22)20-18(23)24-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16H,9-10,19H2,(H,20,23)(H,21,22)/t16-/m0/s1 |
| InChIKey | HDSLKWZYHRLRRL-INIZCTEOSA-N |
| SMILES | NC[C@H](NC(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P301+P312-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |







