A4319112
Fmoc-Dap(Boc)-OH , 97% , 162558-25-0
Synonym(s):
Nα-Fmoc-Nβ-Boc-L -2,3-diaminopropionic acid;Nβ-Boc-Nα-Fmoc-L -2,3-diaminopropionic acid;Fmoc-Dpr(Boc)-OH;N-α-Fmoc-N-β-t.-Boc-L-diaminopropionic acid
CAS NO.:162558-25-0
Empirical Formula: C23H26N2O6
Molecular Weight: 426.46
MDL number: MFCD00235896
EINECS: 2017-001-1
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB28.40 | In Stock |
|
| 1G | RMB63.36 | In Stock |
|
| 5G | RMB216.72 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 131-139 .°C |
| Boiling point: | 652.5±55.0 °C(Predicted) |
| Density | 1.263±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | powder to crystal |
| pka | 3.58±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | Slightly soluble in water. |
| BRN | 7057792 |
| InChIKey | PKAUMAVONPSDRW-IBGZPJMESA-N |
| SMILES | C(O)(=O)[C@H](CNC(OC(C)(C)C)=O)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 162558-25-0(CAS DataBase Reference) |
Description and Uses
As lysine residue its 3-amino group is often used for carrying a tag moiety such as a fluorescent dye, a quencher or biotin.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 2924 29 70 |
| HazardClass | IRRITANT |







